CAS 912761-82-1 is the registry number for 3-Iodo-2-(2,2,2-trifluoroethoxy)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-iodo-2-(2,2,2-trifluoroethoxy)pyridine (CAS 912761-82-1) is a chemical compound with the molecular formula C7H5F3INO and a molecular weight of 303.02 g/mol. IUPAC name: 3-iodo-2-(2,2,2-trifluoroethoxy)pyridine. InChIKey: GUUWZDBHSBLCBA-UHFFFAOYSA-N.
| Molecular formula | C7H5F3INO |
|---|---|
| Molecular weight | 303.02 g/mol |
| IUPAC name | 3-iodo-2-(2,2,2-trifluoroethoxy)pyridine |
| InChIKey | GUUWZDBHSBLCBA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OCC(F)(F)F)I |
Computed by PubChem (NCBI)