cas: 850568-57-9 — see every product listed under this CAS number, including other names
4-Isobutyl-3-nitrophenylboronic acid, 97%, 97% (CAS 850568-57-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115SHX-250mg |
| cas | 850568-57-9 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[4-(2-methylpropyl)-3-nitrophenyl]boronic acid (CAS 850568-57-9) is a chemical compound with the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. IUPAC name: [4-(2-methylpropyl)-3-nitrophenyl]boronic acid. InChIKey: BXGWPVQZLGUZBZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | [4-(2-methylpropyl)-3-nitrophenyl]boronic acid |
| InChIKey | BXGWPVQZLGUZBZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CC(C)C)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)