Products 4540-87-8
CAS 4540-87-8 appears in our catalog under these names: 2-(Benzyloxycarbonylamino)ethylboronic acid, 95%, (2–(((Benzyloxy)carbonyl)amino)ethyl)boronic acid, (2-(((Benzyloxy)carbonyl)amino)ethyl)boronic acid 95%, (2-(((Benzyloxy)carbonyl)amino)ethyl)boronic acid, 95%, 95%, (2-(((Benzyloxy)carbonyl)amino)ethyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 100mg.
2-(phenylmethoxycarbonylamino)ethylboronic acid (CAS 4540-87-8) is a chemical compound with the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. IUPAC name: 2-(phenylmethoxycarbonylamino)ethylboronic acid. InChIKey: KHMDIKNZIMHPTI-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | 2-(phenylmethoxycarbonylamino)ethylboronic acid |
| InChIKey | KHMDIKNZIMHPTI-UHFFFAOYSA-N |
| SMILES | B(CCNC(=O)OCC1=CC=CC=C1)(O)O |
Computed by PubChem (NCBI)