Products 871329-54-3
CAS 871329-54-3 appears in our catalog under these names: 4-tert-Butyl-3-nitrophenylboronic acid, 98%, (4-(tert-Butyl)-3-nitrophenyl)boronic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 250mg.
(4-tert-butyl-3-nitrophenyl)boronic acid (CAS 871329-54-3) is a chemical compound with the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. IUPAC name: (4-tert-butyl-3-nitrophenyl)boronic acid. InChIKey: JDDLCTBTDFIGGM-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | (4-tert-butyl-3-nitrophenyl)boronic acid |
| InChIKey | JDDLCTBTDFIGGM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(C)(C)C)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-tert-Butyl-3-nitrophenylboronic acid, (4-(tert-Butyl)-3-nitrophenyl)boronic acid, (4-tert-butyl-3-nitrophenyl)boronic acid, 4-tert-Butyl-3-nitrobenzeneboronic acid, Boronic acid,B-[4-(1,1-dimethylethyl)-3-nitrophenyl]-, 4-(tert-Butyl)-3-nitrophenylboronic Acid, (4-tert-butyl-3-nitro-phenyl)boronic acid