Products 850568-57-9
CAS 850568-57-9 appears in our catalog under these names: 4-Isobutyl-3-nitrophenylboronic acid, 98%, 4–Isobutyl–3–nitrobenzeneboronic acid, 4-Isobutyl-3-nitrophenylboronic acid, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg.
[4-(2-methylpropyl)-3-nitrophenyl]boronic acid (CAS 850568-57-9) is a chemical compound with the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. IUPAC name: [4-(2-methylpropyl)-3-nitrophenyl]boronic acid. InChIKey: BXGWPVQZLGUZBZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | [4-(2-methylpropyl)-3-nitrophenyl]boronic acid |
| InChIKey | BXGWPVQZLGUZBZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CC(C)C)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)