Products 1414956-78-7
CAS 1414956-78-7 appears in our catalog under these names: [4-(Dimethylcarbamoyl)-2-methoxyphenyl]boronic acid, 95%, (4-(Dimethylcarbamoyl)-2-methoxyphenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
[4-(dimethylcarbamoyl)-2-methoxyphenyl]boronic acid (CAS 1414956-78-7) is a chemical compound with the molecular formula C10H14BNO4 and a molecular weight of 223.04 g/mol. IUPAC name: [4-(dimethylcarbamoyl)-2-methoxyphenyl]boronic acid. InChIKey: HNHYSCGSSDWUFZ-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO4 |
|---|---|
| Molecular weight | 223.04 g/mol |
| IUPAC name | [4-(dimethylcarbamoyl)-2-methoxyphenyl]boronic acid |
| InChIKey | HNHYSCGSSDWUFZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)N(C)C)OC)(O)O |
Computed by PubChem (NCBI)