cas: 380430-64-8 — see every product listed under this CAS number, including other names
4-Isocyanatophenylboronic Acid, Pinacol Ester, 95+%, 95+% (CAS 380430-64-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8HK-5g |
| cas | 380430-64-8 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 8709.20 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 731.60 Pln | |
| Chemat | 1g | 2224.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-(4-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 380430-64-8) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 2-(4-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RHKRIDVZGAXYQE-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 2-(4-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RHKRIDVZGAXYQE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N=C=O |
Computed by PubChem (NCBI)