CAS 2361216-95-5 appears in our catalog under these names: 3-Cyano-2-hydroxyphenylboronic acid pinacol ester, 95%, 2-Hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2361216-95-5) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: ZSPFGKYIIPZZJH-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 2-hydroxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | ZSPFGKYIIPZZJH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C#N)O |
Computed by PubChem (NCBI)