CAS 1188539-34-5 appears in our catalog under these names: Furo[3,2-b]pyridine-6-boronic acid pinacol ester, 95%, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furo(3,2-b)pyridine, 97%, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine (CAS 1188539-34-5) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine. InChIKey: GSSJAXUDJLCMNO-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furo[3,2-b]pyridine |
| InChIKey | GSSJAXUDJLCMNO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=CO3)N=C2 |
Computed by PubChem (NCBI)