CAS 883899-02-3 appears in our catalog under these names: 2-Cyano-3-methoxyphenylboronic acid neopentyl glycol ester, 95%, 2-(5,5-Dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxybenzonitrile, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg.
2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxybenzonitrile (CAS 883899-02-3) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxybenzonitrile. InChIKey: RSLUOIPQHDWWMU-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 2-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-6-methoxybenzonitrile |
| InChIKey | RSLUOIPQHDWWMU-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=C(C(=CC=C2)OC)C#N |
Computed by PubChem (NCBI)