Products 787591-43-9
CAS 787591-43-9 appears in our catalog under these names: 3-Isocyanatophenylboronic acid, pinacol ester, 96%, 2-(3-Isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
2-(3-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 787591-43-9) is a chemical compound with the molecular formula C13H16BNO3 and a molecular weight of 245.08 g/mol. IUPAC name: 2-(3-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VSAATWKRRDGVOD-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO3 |
|---|---|
| Molecular weight | 245.08 g/mol |
| IUPAC name | 2-(3-isocyanatophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VSAATWKRRDGVOD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)N=C=O |
Computed by PubChem (NCBI)