cas: 7116-95-2 — see every product listed under this CAS number, including other names
4-Isopropyl-1,1'-biphenyl (CAS 7116-95-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F729410-1G |
| cas | 7116-95-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 315.53 Pln | |
| Fluorochem | 5g | 862.21 Pln | |
| Fluorochem | 25g | 3158.28 Pln |
| delivery time | 3-4 weeks |
|---|
1-phenyl-4-propan-2-ylbenzene (CAS 7116-95-2) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-phenyl-4-propan-2-ylbenzene. InChIKey: KWSHGRJUSUJPQD-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1-phenyl-4-propan-2-ylbenzene |
| InChIKey | KWSHGRJUSUJPQD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)