cas: 7116-95-2 — see every product listed under this CAS number, including other names
4-Isopropylbiphenyl, 95%, 95% (CAS 7116-95-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LLI-100mg |
| cas | 7116-95-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 486.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-phenyl-4-propan-2-ylbenzene (CAS 7116-95-2) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-phenyl-4-propan-2-ylbenzene. InChIKey: KWSHGRJUSUJPQD-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1-phenyl-4-propan-2-ylbenzene |
| InChIKey | KWSHGRJUSUJPQD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)