CAS 1207-89-2 is the registry number for 3,4,3'-Trimethyl-1,1'-biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2-dimethyl-4-(3-methylphenyl)benzene (CAS 1207-89-2) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1,2-dimethyl-4-(3-methylphenyl)benzene. InChIKey: FVVIZQPBJINMCQ-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1,2-dimethyl-4-(3-methylphenyl)benzene |
| InChIKey | FVVIZQPBJINMCQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC(=C(C=C2)C)C |
Computed by PubChem (NCBI)