Products 4957-14-6
CAS 4957-14-6 appears in our catalog under these names: Di-p-tolylmethane, 97%, Di-p-tolylmethane, 99%, Di–p–tolylmethane, Di-p-tolylmethane, >99.0%(GC), Di-p-tolylmethane, 99%+(GC-MS),RG, 99%+(GC-MS),RG. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 5ml, 25ml.
1-methyl-4-[(4-methylphenyl)methyl]benzene (CAS 4957-14-6) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-methyl-4-[(4-methylphenyl)methyl]benzene. InChIKey: HZAWPPRBCALFRN-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1-methyl-4-[(4-methylphenyl)methyl]benzene |
| InChIKey | HZAWPPRBCALFRN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)