cas: 7116-95-2 — see every product listed under this CAS number, including other names
4-Isopropylbiphenyl (CAS 7116-95-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0171-5G |
| cas | 7116-95-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 644.49 Pln | |
| TCI | 25g | 2188.51 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
1-phenyl-4-propan-2-ylbenzene (CAS 7116-95-2) is a chemical compound with the molecular formula C15H16 and a molecular weight of 196.29 g/mol. IUPAC name: 1-phenyl-4-propan-2-ylbenzene. InChIKey: KWSHGRJUSUJPQD-UHFFFAOYSA-N.
| Molecular formula | C15H16 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 1-phenyl-4-propan-2-ylbenzene |
| InChIKey | KWSHGRJUSUJPQD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)