cas: 925200-28-8 — see every product listed under this CAS number, including other names
4-Isoxazol-5-yl-2-methyl-2 H -pyrazole-3-carboxylic acid (CAS 925200-28-8) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027820-1G |
| cas | 925200-28-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1611.95 Pln |
| delivery time | 2-3 weeks |
|---|
1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid (CAS 925200-28-8) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid. InChIKey: IPKLNHHOWOKQKK-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid |
| InChIKey | IPKLNHHOWOKQKK-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=CC=NO2)C(=O)O |
Computed by PubChem (NCBI)