CAS 862273-50-5 appears in our catalog under these names: 4-Methyl-3-oxo-2,3-dihydro-1h-pyrazolo[3,4-b]pyridine-6-carboxylic acid, 95%, 4-methyl-3-oxo-2,3-dihydro-1H-pyrazolo(3,4-b)pyridine-6-carboxylic Acid, >95% (HPLC), 4-Methyl-3-oxo-1H,2H,3H-pyrazolo(3,4-b)pyridine-6-carboxylic acid. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 25mg, 50mg, 2,5g.
4-methyl-3-oxo-1,2-dihydropyrazolo[3,4-b]pyridine-6-carboxylic acid (CAS 862273-50-5) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 4-methyl-3-oxo-1,2-dihydropyrazolo[3,4-b]pyridine-6-carboxylic acid. InChIKey: VQQRFSOPXLAILL-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 4-methyl-3-oxo-1,2-dihydropyrazolo[3,4-b]pyridine-6-carboxylic acid |
| InChIKey | VQQRFSOPXLAILL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=O)NN2)C(=O)O |
Computed by PubChem (NCBI)