CAS 98555-13-6 is the registry number for 2-Methyl-7-oxo-4,7-dihydropyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-methyl-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 98555-13-6) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 2-methyl-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: IBCBHLQKAIHDIP-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-methyl-7-oxo-1H-pyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| InChIKey | IBCBHLQKAIHDIP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=C(C(=O)N2N1)C(=O)O |
Computed by PubChem (NCBI)