CAS 925200-28-8 appears in our catalog under these names: 1-Methyl-4-(1,2-oxazol-5-yl)-1h-pyrazole-5-carboxylic acid, 95%, 4-Isoxazol-5-yl-2-methyl-2 H -pyrazole-3-carboxylic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid (CAS 925200-28-8) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid. InChIKey: IPKLNHHOWOKQKK-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 1-methyl-4-(1,2-oxazol-5-yl)pyrazole-5-carboxylic acid |
| InChIKey | IPKLNHHOWOKQKK-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=CC=NO2)C(=O)O |
Computed by PubChem (NCBI)