CAS 743452-21-3 appears in our catalog under these names: Methyl 1-hydroxy-1h-1,2,3-benzotriazole-6-carboxylate, 95%, Methyl 1-hydroxy-1H-1,2,3-benzotriazole-6-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
Methyl 3-hydroxybenzotriazole-5-carboxylate (CAS 743452-21-3) is a chemical compound with the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. IUPAC name: methyl 3-hydroxybenzotriazole-5-carboxylate. InChIKey: OJPXUYCYQVRBHG-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O3 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | methyl 3-hydroxybenzotriazole-5-carboxylate |
| InChIKey | OJPXUYCYQVRBHG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)N=NN2O |
Computed by PubChem (NCBI)