4-Methoxy-3-methylphenylboronic acid, 98%
cas: 175883-62-2 — see every product listed under this CAS number, including other names
4-Methoxy-3-methylphenylboronic acid, 98% (CAS 175883-62-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A141652-1g |
| cas | 175883-62-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 10g | 209.06 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1043.44 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 165.20 Pln | |
| Chemat | 25g | 285.20 Pln | |
| Chemat | 100g | 962.00 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 236.61 Pln | |
| BLDpharm | 25g | 375.45 Pln | |
| BLDpharm | 100g | 1119.63 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(4-methoxy-3-methylphenyl)boronic acid (CAS 175883-62-2) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (4-methoxy-3-methylphenyl)boronic acid. InChIKey: PXVDQGVAZBTFIB-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (4-methoxy-3-methylphenyl)boronic acid |
| InChIKey | PXVDQGVAZBTFIB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-methoxy-3-methylphenyl)boronic acid, 4-Methoxy-3-methylphenylboronic acid, 4-Methoxy-3-methylbenzeneboronic acid, 4-Methoxy-3-methylphenylboronicAcid, Boronic acid, B-(4-methoxy-3-methylphenyl)-, (4-methoxy-3-methyl-phenyl)boronic Acid, 4-Methoxy-3-methylphenylboronic Acid (contains varying amounts of Anhydride), Boronic acid, (4-methoxy-3-methylphenyl)-, 4-methoxy-3-methyl phenylboronic acid, 4-methoxy-3-methyl-phenylboronic acid