cas: 10397-28-1 — see every product listed under this CAS number, including other names
4-Methoxy-3-nitrobenzoyl chloride, 95%, 95% (CAS 10397-28-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11967C-100mg |
| cas | 10397-28-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 856.40 Pln | |
| Chemat | 1g | 1648.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-3-nitrobenzoyl chloride (CAS 10397-28-1) is a chemical compound with the molecular formula C8H6ClNO4 and a molecular weight of 215.59 g/mol. IUPAC name: 4-methoxy-3-nitrobenzoyl chloride. InChIKey: FUXMQFBGQSNVBM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO4 |
|---|---|
| Molecular weight | 215.59 g/mol |
| IUPAC name | 4-methoxy-3-nitrobenzoyl chloride |
| InChIKey | FUXMQFBGQSNVBM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)