cas: 88686-30-0 — see every product listed under this CAS number, including other names
4-Methoxy-7-methylbenzo[d]thiazol-2-amine 95% (CAS 88686-30-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A294871-100mg |
| cas | 88686-30-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1165.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A294871 |
4-methoxy-7-methyl-1,3-benzothiazol-2-amine (CAS 88686-30-0) is a chemical compound with the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. IUPAC name: 4-methoxy-7-methyl-1,3-benzothiazol-2-amine. InChIKey: BPFSLCTUFLBWNK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2OS |
|---|---|
| Molecular weight | 194.26 g/mol |
| IUPAC name | 4-methoxy-7-methyl-1,3-benzothiazol-2-amine |
| InChIKey | BPFSLCTUFLBWNK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)OC)N=C(S2)N |
Computed by PubChem (NCBI)