cas: 794-94-5 — see every product listed under this CAS number, including other names
4-Methoxybenzoic Anhydride, >97.0%(GC)(T) (CAS 794-94-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M1973-5G |
| cas | 794-94-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 501.89 Pln | |
| TCI | 25g | 2257.35 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC)(T) |
(4-methoxybenzoyl) 4-methoxybenzoate (CAS 794-94-5) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (4-methoxybenzoyl) 4-methoxybenzoate. InChIKey: YGMHIBLUWGDWKP-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (4-methoxybenzoyl) 4-methoxybenzoate |
| InChIKey | YGMHIBLUWGDWKP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)OC(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)