cas: 85107-55-7 — see every product listed under this CAS number, including other names
4-Methoxycarbonyl-2-nitrophenylboronic acid, 97%, 97% (CAS 85107-55-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119GJ9-250mg |
| cas | 85107-55-7 |
| size | 250mg |
| availability | 140g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 100g | 698.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-methoxycarbonyl-2-nitrophenyl)boronic acid (CAS 85107-55-7) is a chemical compound with the molecular formula C8H8BNO6 and a molecular weight of 224.97 g/mol. IUPAC name: (4-methoxycarbonyl-2-nitrophenyl)boronic acid. InChIKey: SFEJGHJCGQNFQC-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO6 |
|---|---|
| Molecular weight | 224.97 g/mol |
| IUPAC name | (4-methoxycarbonyl-2-nitrophenyl)boronic acid |
| InChIKey | SFEJGHJCGQNFQC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)