4-Methoxycarbonyl-2-nitrophenylboronic acid, 97%
cas: 85107-55-7 — see every product listed under this CAS number, including other names
4-Methoxycarbonyl-2-nitrophenylboronic acid, 97% (CAS 85107-55-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 1g, 500g, 250mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | BB-2461-5g |
| cas | 85107-55-7 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 100g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 148.92 Pln | |
| Fluorochem | 10g | 211.40 Pln | |
| Fluorochem | 25g | 398.84 Pln | |
| Fluorochem | 100g | 1304.77 Pln | |
| Fluorochem | 500g | 6193.67 Pln | |
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 398.19 Pln | |
| Ambeed | 100g | 1265.94 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 100g | 698.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 153.30 Pln | |
| BLDpharm | 10g | 231.05 Pln | |
| BLDpharm | 25g | 425.43 Pln | |
| BLDpharm | 100g | 1358.44 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
(4-methoxycarbonyl-2-nitrophenyl)boronic acid (CAS 85107-55-7) is a chemical compound with the molecular formula C8H8BNO6 and a molecular weight of 224.97 g/mol. IUPAC name: (4-methoxycarbonyl-2-nitrophenyl)boronic acid. InChIKey: SFEJGHJCGQNFQC-UHFFFAOYSA-N.
| Molecular formula | C8H8BNO6 |
|---|---|
| Molecular weight | 224.97 g/mol |
| IUPAC name | (4-methoxycarbonyl-2-nitrophenyl)boronic acid |
| InChIKey | SFEJGHJCGQNFQC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Methoxycarbonyl-2-nitrophenylboronic acid, (4-methoxycarbonyl-2-nitrophenyl)boronic acid, 4-(methoxycarbonyl)-2-nitrophenylboronic acid, (4-(methoxycarbonyl)-2-nitrophenyl)boronic acid, (4-methoxycarbonyl-2-nitro-phenyl)boronic Acid, 4-(methoxycarbonyl)-2-nitrobenzeneboronic acid, [4-(methoxycarbonyl)-2-nitrophenyl]boronic acid, 4-Methoxycarbonyl-2-nitrobenzeneboronic acid, SFEJGHJCGQNFQC-UHFFFAOYSA-N, 4-methoxycarbonyl-2-nitrophenylboronic acid, AldrichCPR