cas: 76487-56-4 — see every product listed under this CAS number, including other names
4-Methoxyphenyl 4-(3-Butenyloxy)benzoate, >98.0%(GC) (CAS 76487-56-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M2106-1G |
| cas | 76487-56-4 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 418.30 Pln | |
| TCI | 5g | 1568.93 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
(4-methoxyphenyl) 4-but-3-enoxybenzoate (CAS 76487-56-4) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: (4-methoxyphenyl) 4-but-3-enoxybenzoate. InChIKey: CXPLNUIZUUBDCU-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | (4-methoxyphenyl) 4-but-3-enoxybenzoate |
| InChIKey | CXPLNUIZUUBDCU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)OCCC=C |
Computed by PubChem (NCBI)