cas: 1312937-40-8 — see every product listed under this CAS number, including other names
4-Methoxyquinazoline-6,7-diol, 95%, 95% (CAS 1312937-40-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPE-100mg |
| cas | 1312937-40-8 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxyquinazoline-6,7-diol (CAS 1312937-40-8) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 4-methoxyquinazoline-6,7-diol. InChIKey: WJRJMGINHRAKFU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-methoxyquinazoline-6,7-diol |
| InChIKey | WJRJMGINHRAKFU-UHFFFAOYSA-N |
| SMILES | COC1=NC=NC2=CC(=C(C=C21)O)O |
Computed by PubChem (NCBI)