Products 876709-30-7

CAS 876709-30-7 is the registry number for 5-(1H-Imidazol-1-ylmethyl)-2-furoic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(imidazol-1-ylmethyl)furan-2-carboxylic acid (CAS 876709-30-7) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 5-(imidazol-1-ylmethyl)furan-2-carboxylic acid. InChIKey: NNJVURHBCVIUHK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8N2O3
Molecular weight192.17 g/mol
IUPAC name5-(imidazol-1-ylmethyl)furan-2-carboxylic acid
InChIKeyNNJVURHBCVIUHK-UHFFFAOYSA-N
SMILESC1=CN(C=N1)CC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)