cas: 15733-83-2 — see every product listed under this CAS number, including other names
4-Methoxyquinoline-2-carboxylic acid, 98% (CAS 15733-83-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066330-1G |
| cas | 15733-83-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 362.39 Pln | |
| Fluorochem | 10g | 591.48 Pln | |
| Fluorochem | 25g | 1393.28 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-methoxyquinoline-2-carboxylic acid (CAS 15733-83-2) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 4-methoxyquinoline-2-carboxylic acid. InChIKey: AVBKMSSLAIKOGM-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 4-methoxyquinoline-2-carboxylic acid |
| InChIKey | AVBKMSSLAIKOGM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)