cas: 879636-95-0 — see every product listed under this CAS number, including other names
4-Methyl-2-(3-methoxyphenyl)thiazole-5-carboxylic acid, 98%, 98% (CAS 879636-95-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVXC-100mg |
| cas | 879636-95-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 837.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 879636-95-0) is a chemical compound with the molecular formula C12H11NO3S and a molecular weight of 249.29 g/mol. IUPAC name: 2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: WFBWIROXKGGXAW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3S |
|---|---|
| Molecular weight | 249.29 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | WFBWIROXKGGXAW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=CC=C2)OC)C(=O)O |
Computed by PubChem (NCBI)