cas: 300383-07-7 — see every product listed under this CAS number, including other names
4-Methyl-3-(piperidin-1-ylsulfonyl)benzoic acid, 95+%, 95+% (CAS 300383-07-7) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C36F-500mg |
| cas | 300383-07-7 |
| size | 500mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 808.40 Pln | |
| Chemat | 1g | 1024.40 Pln | |
| Chemat | 5g | 2867.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
4-methyl-3-piperidin-1-ylsulfonylbenzoic acid (CAS 300383-07-7) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 4-methyl-3-piperidin-1-ylsulfonylbenzoic acid. InChIKey: CYDFTQZJAGEURD-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 4-methyl-3-piperidin-1-ylsulfonylbenzoic acid |
| InChIKey | CYDFTQZJAGEURD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)S(=O)(=O)N2CCCCC2 |
Computed by PubChem (NCBI)