Products 603118-20-3
CAS 603118-20-3 appears in our catalog under these names: 3-[(3-Methylpiperidin-1-yl)sulfonyl]benzoic acid, 95%, 3-((3-Methylpiperidin-1-yl)sulfonyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(3-methylpiperidin-1-yl)sulfonylbenzoic acid (CAS 603118-20-3) is a chemical compound with the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. IUPAC name: 3-(3-methylpiperidin-1-yl)sulfonylbenzoic acid. InChIKey: OGTFNSKWZVXMCO-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4S |
|---|---|
| Molecular weight | 283.35 g/mol |
| IUPAC name | 3-(3-methylpiperidin-1-yl)sulfonylbenzoic acid |
| InChIKey | OGTFNSKWZVXMCO-UHFFFAOYSA-N |
| SMILES | CC1CCCN(C1)S(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)