CAS 616-83-1 appears in our catalog under these names: 4–Methyl–3–nitrobenzenesulfonyl Chloride, 4-Methyl-3-nitrobenzenesulfonyl chloride, 95% , 4-Methyl-3-nitrobenzenesulfonyl Chloride, >98.0%(GC)(T), 4-Methyl-3-nitrobenzenesulfonyl chloride, 4-Methyl-3-nitrobenzenesulphonyl chloride, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Fluorochem. Available pack sizes: 100g, 1g, 25g, 5g, 10g, 50g, 250g, 500g.
4-methyl-3-nitrobenzenesulfonyl chloride (CAS 616-83-1) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 4-methyl-3-nitrobenzenesulfonyl chloride. InChIKey: OQFYBGANSUNUAO-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 4-methyl-3-nitrobenzenesulfonyl chloride |
| InChIKey | OQFYBGANSUNUAO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)