CAS 15071-04-2 appears in our catalog under these names: 8-methyl-2H-[1,3]dioxolo[4,5-g]chromen-6-one, 95%, 4–Methyl–6,7–methylenedioxycoumarin, 4-Methylayapin/ 99.9%, 4-Methyl-6,7-methylenedioxycoumarin, 8-Methyl-6H-[1,3]dioxolo[4,5-g]chromen-6-one, 97%, 97%. Offered by: Combi-blocks, GLPBio, TargetMol, TCI, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, Get quote.
8-methyl-[1,3]dioxolo[4,5-g]chromen-6-one (CAS 15071-04-2) is a chemical compound with the molecular formula C11H8O4 and a molecular weight of 204.18 g/mol. IUPAC name: 8-methyl-[1,3]dioxolo[4,5-g]chromen-6-one. InChIKey: XAOGHIKJQRXPHX-UHFFFAOYSA-N.
| Molecular formula | C11H8O4 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | 8-methyl-[1,3]dioxolo[4,5-g]chromen-6-one |
| InChIKey | XAOGHIKJQRXPHX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=CC3=C(C=C12)OCO3 |
Computed by PubChem (NCBI)