cas: 15723-90-7 — see every product listed under this CAS number, including other names
4-Nitrobenzamidine Hydrochloride, >98.0%(HPLC)(T) (CAS 15723-90-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0989-5G |
| cas | 15723-90-7 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 251.11 Pln | |
| TCI | 25g | 905.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
4-nitrobenzenecarboximidamide;hydrochloride (CAS 15723-90-7) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 4-nitrobenzenecarboximidamide;hydrochloride. InChIKey: CJXJAUKCHHAJQN-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 4-nitrobenzenecarboximidamide;hydrochloride |
| InChIKey | CJXJAUKCHHAJQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)