cas: 15723-90-7 — see every product listed under this CAS number, including other names
4-Nitrobenzamidine hydrochloride, 95% (CAS 15723-90-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092216-1G |
| cas | 15723-90-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 294.71 Pln | |
| Fluorochem | 25g | 346.77 Pln | |
| Fluorochem | 100g | 1205.84 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-nitrobenzenecarboximidamide;hydrochloride (CAS 15723-90-7) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 4-nitrobenzenecarboximidamide;hydrochloride. InChIKey: CJXJAUKCHHAJQN-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 4-nitrobenzenecarboximidamide;hydrochloride |
| InChIKey | CJXJAUKCHHAJQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)