4-Nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 97%
cas: 1285533-35-8 — see every product listed under this CAS number, including other names
4-Nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 97% (CAS 1285533-35-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A114765-100mg |
| cas | 1285533-35-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 804.25 Pln | |
| Ambeed | 250mg | 1254.81 Pln | |
| Ambeed | 1g | 3179.44 Pln | |
| Ambeed | 5g | 8786.44 Pln | |
| BLDpharm | 100mg | 791.97 Pln | |
| BLDpharm | 250mg | 1230.70 Pln | |
| BLDpharm | 1g | 3124.48 Pln | |
| BLDpharm | 5g | 8616.99 Pln | |
| Fluorochem | 100mg | 1143.37 Pln | |
| Fluorochem | 250mg | 1762.94 Pln | |
| Fluorochem | 1g | 4418.25 Pln | |
| Chemat | 100mg | 621.20 Pln | |
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2387.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
1-hydroxy-4-nitro-3H-2,1-benzoxaborole (CAS 1285533-35-8) is a chemical compound with the molecular formula C7H6BNO4 and a molecular weight of 178.94 g/mol. IUPAC name: 1-hydroxy-4-nitro-3H-2,1-benzoxaborole. InChIKey: RTDNSCFUOJSBLZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BNO4 |
|---|---|
| Molecular weight | 178.94 g/mol |
| IUPAC name | 1-hydroxy-4-nitro-3H-2,1-benzoxaborole |
| InChIKey | RTDNSCFUOJSBLZ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C(=CC=C2)[N+](=O)[O-])O |
Computed by PubChem (NCBI)