cas: 1823353-28-1 — see every product listed under this CAS number, including other names
4-Nitrobenzo[d]isoxazole, 97% (CAS 1823353-28-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F339547-100MG |
| cas | 1823353-28-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 627.92 Pln | |
| Fluorochem | 250mg | 1028.82 Pln | |
| Fluorochem | 1g | 2481.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-nitro-1,2-benzoxazole (CAS 1823353-28-1) is a chemical compound with the molecular formula C7H4N2O3 and a molecular weight of 164.12 g/mol. IUPAC name: 4-nitro-1,2-benzoxazole. InChIKey: PWRLVIBSLCSATP-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O3 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 4-nitro-1,2-benzoxazole |
| InChIKey | PWRLVIBSLCSATP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NOC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)