4-Nitrophenyl butyrate, 97%, 97%
cas: 2635-84-9 — see every product listed under this CAS number, including other names
4-Nitrophenyl butyrate, 97%, 97% (CAS 2635-84-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g, 100g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113SUO-250mg |
| cas | 2635-84-9 |
| size | 250mg |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 500mg | 83.60 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 174.80 Pln | |
| Chemat | 25g | 419.60 Pln | |
| Chemat | 100g | 1158.80 Pln | |
| Chemat | 1kg | 9035.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
P-nitrophenyl butyrate is a butyrate ester resulting from the formal condensation of the hydroxy group of 4-nitrophenol with the carboxy group of butyric acid. It is a C-nitro compound and a butyrate ester. It is functionally related to a 4-nitrophenol.
Source: ChEBI
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | (4-nitrophenyl) butanoate |
| InChIKey | DVDUMIQZEUTAGK-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)