CAS 906564-59-8 appears in our catalog under these names: Alkyne NHS ester (hexynoic acid NHS ester), 95%, 5-Hexynoic NHS Ester, Propargyl–C2–NHS ester, 5-Hexynoic Acid Nhs Ester, 97%, 97%, Propargyl-C2-NHS ester, 99.84%. Offered by: Lumiprobe, TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 500mg, 250mg, 1g, 5g, 10g.
(2,5-dioxopyrrolidin-1-yl) hex-5-ynoate (CAS 906564-59-8) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) hex-5-ynoate. InChIKey: CXSSWEBEHUYETJ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) hex-5-ynoate |
| InChIKey | CXSSWEBEHUYETJ-UHFFFAOYSA-N |
| SMILES | C#CCCCC(=O)ON1C(=O)CCC1=O |
Computed by PubChem (NCBI)