Products 73622-98-7

CAS 73622-98-7 is the registry number for 1-Carboxyethyl n-phenylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(phenylcarbamoyloxy)propanoic acid (CAS 73622-98-7) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2-(phenylcarbamoyloxy)propanoic acid. InChIKey: HYIHYWQSOXTJFS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO4
Molecular weight209.20 g/mol
IUPAC name2-(phenylcarbamoyloxy)propanoic acid
InChIKeyHYIHYWQSOXTJFS-UHFFFAOYSA-N
SMILESCC(C(=O)O)OC(=O)NC1=CC=CC=C1

Computed by PubChem (NCBI)