Products 59382-60-4
CAS 59382-60-4 appears in our catalog under these names: Ethyl 2-methyl-3-nitrobenzoate, 95%, Ethyl 2-methyl-3-nitrobenzoate 97%, Ethyl 2-methyl-3-nitrobenzoate, 97%, 97%, ethyl 2-methyl-3-nitrobenzoate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 25g, 100g, 500g, 10g.
Ethyl 2-methyl-3-nitrobenzoate (CAS 59382-60-4) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: ethyl 2-methyl-3-nitrobenzoate. InChIKey: XINYBVBBEWUEPZ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | ethyl 2-methyl-3-nitrobenzoate |
| InChIKey | XINYBVBBEWUEPZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])C |
Computed by PubChem (NCBI)