CAS 106567-41-3 appears in our catalog under these names: 2,4,6-Trimethyl-3-nitrobenzoic acid, 2,4,6-Trimethyl-3-nitrobenzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 250mg, 10g, 1g.
2,4,6-trimethyl-3-nitrobenzoic acid (CAS 106567-41-3) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2,4,6-trimethyl-3-nitrobenzoic acid. InChIKey: MNCAEAPELOWRRK-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2,4,6-trimethyl-3-nitrobenzoic acid |
| InChIKey | MNCAEAPELOWRRK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)O)C)[N+](=O)[O-])C |
Computed by PubChem (NCBI)