4-Nitrophenyl decanoate, 98%
cas: 1956-09-8 — see every product listed under this CAS number, including other names
4-Nitrophenyl decanoate, 98% (CAS 1956-09-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A645697-100mg |
| cas | 1956-09-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 753.09 Pln | |
| BLDpharm | 5g | 2124.83 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 500mg | 256.40 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 890.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
(4-nitrophenyl) decanoate (CAS 1956-09-8) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (4-nitrophenyl) decanoate. InChIKey: RRNKCSIEGPOIKI-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (4-nitrophenyl) decanoate |
| InChIKey | RRNKCSIEGPOIKI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
