Products 1956-09-8
CAS 1956-09-8 appears in our catalog under these names: 4-Nitrophenyl decanoate, 95%, 4-Nitrophenyl decanoate, 95+%, 4-Nitrophenyl decanoate 98%, 4-Nitrophenyl decanoate, 98%, 98%, 4-Nitrophenyl decanoate, 98.04%. Offered by: Combi-blocks, AmBeed, Chemat, MedChemExpress, Roth. Available pack sizes: 250mg, 1g, 10g, 25g, 100mg, 5g, 500mg, 250 mg.
(4-nitrophenyl) decanoate (CAS 1956-09-8) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (4-nitrophenyl) decanoate. InChIKey: RRNKCSIEGPOIKI-UHFFFAOYSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (4-nitrophenyl) decanoate |
| InChIKey | RRNKCSIEGPOIKI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)