cas: 13509-19-8 — see every product listed under this CAS number, including other names
4-Nitropicolinic acid, 97%, 97% (CAS 13509-19-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LWK-100mg |
| cas | 13509-19-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 500mg | 160.40 Pln | |
| Chemat | 1g | 242.00 Pln | |
| Chemat | 5g | 962.00 Pln | |
| Chemat | 10g | 1864.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-nitropyridine-2-carboxylic acid (CAS 13509-19-8) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 4-nitropyridine-2-carboxylic acid. InChIKey: USTVSOYPMQZLSA-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 4-nitropyridine-2-carboxylic acid |
| InChIKey | USTVSOYPMQZLSA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)