cas: 13509-19-8 — see every product listed under this CAS number, including other names
4-Nitropicolinic acid, 97% (CAS 13509-19-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209471-1G |
| cas | 13509-19-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 1158.98 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-nitropyridine-2-carboxylic acid (CAS 13509-19-8) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: 4-nitropyridine-2-carboxylic acid. InChIKey: USTVSOYPMQZLSA-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | 4-nitropyridine-2-carboxylic acid |
| InChIKey | USTVSOYPMQZLSA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)