cas: 16442-58-3 — see every product listed under this CAS number, including other names
4-Phenyl-1,3,4,5-tetrahydro-2H-benzo[b][1,4]diazepin-2-one 96% (CAS 16442-58-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A746566-1g |
| cas | 16442-58-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 2161.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A746566 |
2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one (CAS 16442-58-3) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: 2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one. InChIKey: BPBSKHLEGJWMBO-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-phenyl-1,2,3,5-tetrahydro-1,5-benzodiazepin-4-one |
| InChIKey | BPBSKHLEGJWMBO-UHFFFAOYSA-N |
| SMILES | C1C(NC2=CC=CC=C2NC1=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)